C21H44O6Si — CID 11407516
(4R,5R,6R,7S)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-bis(methoxymethoxy)undec-1-en-4-ol (PubChem CID 11407516) has the molecular formula C21H44O6Si and a molecular weight of 420.66 g/mol. Its IUPAC name is (4R,5R,6R,7S)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-bis(methoxymethoxy)undec-1-en-4-ol.
| Compound Name | (4R,5R,6R,7S)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-bis(methoxymethoxy)undec-1-en-4-ol |
|---|---|
| PubChem CID | 11407516 |
| Molecular Formula | C21H44O6Si |
| Molecular Weight | 420.66 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | (4R,5R,6R,7S)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-bis(methoxymethoxy)undec-1-en-4-ol |
| SMILES | C=CC[C@@H](O)[C@@H](OCOC)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CCCC)OCOC |
| InChI | InChI=1S/C21H44O6Si/c1-10-12-14-18(25-15-23-6)20(27-28(8,9)21(3,4)5)19(26-16-24-7)17(22)13-11-2/h11,17-20,22H,2,10,12-16H2,1,3-9H3/t17-,18+,19-,20-/m1/s1 |
| InChIKey | DILKJGQLAGNPOS-IYWMVGAKSA-N |
| XLogP | 4.48 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|