C14H11Cl3N2 — CID 114076229
4-chloro-2-(2,5-dichlorophenyl)-5,6,7,8-tetrahydroquinazoline (PubChem CID 114076229) has the molecular formula C14H11Cl3N2 and a molecular weight of 313.62 g/mol. Its IUPAC name is 4-chloro-2-(2,5-dichlorophenyl)-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 4-chloro-2-(2,5-dichlorophenyl)-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 114076229 |
| Molecular Formula | C14H11Cl3N2 |
| Molecular Weight | 313.62 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 4-chloro-2-(2,5-dichlorophenyl)-5,6,7,8-tetrahydroquinazoline |
| SMILES | Clc1ccc(Cl)c(-c2nc(Cl)c3c(n2)CCCC3)c1 |
| InChI | InChI=1S/C14H11Cl3N2/c15-8-5-6-11(16)10(7-8)14-18-12-4-2-1-3-9(12)13(17)19-14/h5-7H,1-4H2 |
| InChIKey | UYIZDGUICIHJBQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |