C22H27NO8 — CID 11407849
[[(3S,4S)-4-[methoxy-(3,4,5-trimethoxyphenyl)methyl]oxolan-3-yl]-phenylmethyl] nitrate (PubChem CID 11407849) has the molecular formula C22H27NO8 and a molecular weight of 433.46 g/mol. Its IUPAC name is [[(3S,4S)-4-[methoxy-(3,4,5-trimethoxyphenyl)methyl]oxolan-3-yl]-phenylmethyl] nitrate.
| Compound Name | [[(3S,4S)-4-[methoxy-(3,4,5-trimethoxyphenyl)methyl]oxolan-3-yl]-phenylmethyl] nitrate |
|---|---|
| PubChem CID | 11407849 |
| Molecular Formula | C22H27NO8 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | [[(3S,4S)-4-[methoxy-(3,4,5-trimethoxyphenyl)methyl]oxolan-3-yl]-phenylmethyl] nitrate |
| SMILES | COc1cc(C(OC)[C@@H]2COC[C@H]2C(O[N+](=O)[O-])c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H27NO8/c1-26-18-10-15(11-19(27-2)22(18)29-4)20(28-3)16-12-30-13-17(16)21(31-23(24)25)14-8-6-5-7-9-14/h5-11,16-17,20-21H,12-13H2,1-4H3/t16-,17-,20?,21?/m1/s1 |
| InChIKey | BOCOTXBMVZCPDX-FBIZOPLVSA-N |
| XLogP | 3.61 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|