C15H21N3 — CID 114079301
13-methyl-4-(2-methylpropyl)-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene (PubChem CID 114079301) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 13-methyl-4-(2-methylpropyl)-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene.
| Compound Name | 13-methyl-4-(2-methylpropyl)-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
|---|---|
| PubChem CID | 114079301 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 13-methyl-4-(2-methylpropyl)-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
| SMILES | Cc1cccc2nc3c(n12)CN(CC(C)C)CC3 |
| InChI | InChI=1S/C15H21N3/c1-11(2)9-17-8-7-13-14(10-17)18-12(3)5-4-6-15(18)16-13/h4-6,11H,7-10H2,1-3H3 |
| InChIKey | CAGYTMPAXHFNSG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |