C13H18Cl2N2 — CID 114079689
N-[1-(2,3-dichlorophenyl)ethyl]-N-methylpyrrolidin-3-amine (PubChem CID 114079689) has the molecular formula C13H18Cl2N2 and a molecular weight of 273.21 g/mol. Its IUPAC name is N-[1-(2,3-dichlorophenyl)ethyl]-N-methylpyrrolidin-3-amine.
| Compound Name | N-[1-(2,3-dichlorophenyl)ethyl]-N-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 114079689 |
| Molecular Formula | C13H18Cl2N2 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-[1-(2,3-dichlorophenyl)ethyl]-N-methylpyrrolidin-3-amine |
| SMILES | CC(c1cccc(Cl)c1Cl)N(C)C1CCNC1 |
| InChI | InChI=1S/C13H18Cl2N2/c1-9(17(2)10-6-7-16-8-10)11-4-3-5-12(14)13(11)15/h3-5,9-10,16H,6-8H2,1-2H3 |
| InChIKey | IBRYJJSLRKUUET-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |