C23H18FNO5S — CID 11408006
2-[5-fluoro-2-methyl-1-(3-phenoxyphenyl)sulfonylindol-3-yl]acetic acid (PubChem CID 11408006) has the molecular formula C23H18FNO5S and a molecular weight of 439.46 g/mol. Its IUPAC name is 2-[5-fluoro-2-methyl-1-(3-phenoxyphenyl)sulfonylindol-3-yl]acetic acid.
| Compound Name | 2-[5-fluoro-2-methyl-1-(3-phenoxyphenyl)sulfonylindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 11408006 |
| Molecular Formula | C23H18FNO5S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 2-[5-fluoro-2-methyl-1-(3-phenoxyphenyl)sulfonylindol-3-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c2cc(F)ccc2n1S(=O)(=O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C23H18FNO5S/c1-15-20(14-23(26)27)21-12-16(24)10-11-22(21)25(15)31(28,29)19-9-5-8-18(13-19)30-17-6-3-2-4-7-17/h2-13H,14H2,1H3,(H,26,27) |
| InChIKey | MVYRRBZLEBEGBR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |