C11H10F5NS — CID 114080093
2-methyl-N-(2,3,4,5,6-pentafluorophenyl)thiolan-3-amine (PubChem CID 114080093) has the molecular formula C11H10F5NS and a molecular weight of 283.27 g/mol. Its IUPAC name is 2-methyl-N-(2,3,4,5,6-pentafluorophenyl)thiolan-3-amine.
| Compound Name | 2-methyl-N-(2,3,4,5,6-pentafluorophenyl)thiolan-3-amine |
|---|---|
| PubChem CID | 114080093 |
| Molecular Formula | C11H10F5NS |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-methyl-N-(2,3,4,5,6-pentafluorophenyl)thiolan-3-amine |
| SMILES | CC1SCCC1Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H10F5NS/c1-4-5(2-3-18-4)17-11-9(15)7(13)6(12)8(14)10(11)16/h4-5,17H,2-3H2,1H3 |
| InChIKey | ZWEVMGNGRYGTCJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|