C23H44O4Si2 — CID 11408066
methyl (1S,2E,4S,5S)-4-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxy-5-formylcyclooct-2-ene-1-carboxylate (PubChem CID 11408066) has the molecular formula C23H44O4Si2 and a molecular weight of 440.77 g/mol. Its IUPAC name is methyl (1S,2E,4S,5S)-4-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxy-5-formylcyclooct-2-ene-1-carboxylate.
| Compound Name | methyl (1S,2E,4S,5S)-4-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxy-5-formylcyclooct-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 11408066 |
| Molecular Formula | C23H44O4Si2 |
| Molecular Weight | 440.77 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | methyl (1S,2E,4S,5S)-4-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxy-5-formylcyclooct-2-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CCC[C@@H](C=O)[C@@H]([Si](C)(C)C(C)(C)C)/C=C\1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O4Si2/c1-22(2,3)28(8,9)20-15-19(27-29(10,11)23(4,5)6)18(21(25)26-7)14-12-13-17(20)16-24/h15-18,20H,12-14H2,1-11H3/b19-15+/t17-,18-,20-/m0/s1 |
| InChIKey | ZHLZHKBGSHRVHN-XTOYHAPASA-N |
| XLogP | 6.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.77 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|