About 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl 2-aminopyridine-3-carboxylate
2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl 2-aminopyridine-3-carboxylate (PubChem CID 11408093) has the molecular formula C16H12F6N2O4S
and a molecular weight of 442.34 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl 2-aminopyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl 2-aminopyridine-3-carboxylate |
| PubChem CID | 11408093 |
| Molecular Formula | C16H12F6N2O4S |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl 2-aminopyridine-3-carboxylate |
| SMILES | Nc1ncccc1C(=O)OCCS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H12F6N2O4S/c17-15(18,19)9-6-10(16(20,21)22)8-11(7-9)29(26,27)5-4-28-14(25)12-2-1-3-24-13(12)23/h1-3,6-8H,4-5H2,(H2,23,24) |
| InChIKey | GFWCRSXXRUYBDI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl 2-aminopyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl 2-aminopyridine-3-carboxylate?
The IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl 2-aminopyridine-3-carboxylate (CID 11408093) is 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl 2-aminopyridine-3-carboxylate.
What is the SMILES notation for 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl 2-aminopyridine-3-carboxylate?
The canonical SMILES for 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl 2-aminopyridine-3-carboxylate is Nc1ncccc1C(=O)OCCS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl 2-aminopyridine-3-carboxylate?
The InChIKey is GFWCRSXXRUYBDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F6N2O4S/c17-15(18,19)9-6-10(16(20,21)22)8-11(7-9)29(26,27)5-4-28-14(25)12-2-1-3-24-13(12)23/h1-3,6-8H,4-5H2,(H2,23,24).
What are the key properties of 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl 2-aminopyridine-3-carboxylate?
2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl 2-aminopyridine-3-carboxylate has a molecular weight of 442.34 g/mol, XLogP of 3.33, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl 2-aminopyridine-3-carboxylate is sourced from PubChem (CID 11408093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).