C24H46O5Si — CID 11408110
[(E,1S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methyl-1-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]hex-4-enyl] 2,2-dimethylpropanoate (PubChem CID 11408110) has the molecular formula C24H46O5Si and a molecular weight of 442.71 g/mol. Its IUPAC name is [(E,1S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methyl-1-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]hex-4-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,1S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methyl-1-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]hex-4-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11408110 |
| Molecular Formula | C24H46O5Si |
| Molecular Weight | 442.71 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | [(E,1S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methyl-1-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]hex-4-enyl] 2,2-dimethylpropanoate |
| SMILES | C/C(=C\CC[C@H](OC(=O)C(C)(C)C)[C@@]1(C)COC(C)(C)O1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O5Si/c1-18(16-27-30(11,12)22(5,6)7)14-13-15-19(28-20(25)21(2,3)4)24(10)17-26-23(8,9)29-24/h14,19H,13,15-17H2,1-12H3/b18-14+/t19-,24+/m0/s1 |
| InChIKey | ZQBJRFKITFMWMN-KFJDUODQSA-N |
| XLogP | 6.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.71 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|