About N,2-dimethyl-6-[7-(1,3-thiazol-2-ylmethoxy)quinolin-4-yl]oxy-1-benzofuran-3-carboxamide
N,2-dimethyl-6-[7-(1,3-thiazol-2-ylmethoxy)quinolin-4-yl]oxy-1-benzofuran-3-carboxamide (PubChem CID 11408185) has the molecular formula C24H19N3O4S
and a molecular weight of 445.50 g/mol. Its IUPAC name is N,2-dimethyl-6-[7-(1,3-thiazol-2-ylmethoxy)quinolin-4-yl]oxy-1-benzofuran-3-carboxamide.
Molecular Properties
| Compound Name | N,2-dimethyl-6-[7-(1,3-thiazol-2-ylmethoxy)quinolin-4-yl]oxy-1-benzofuran-3-carboxamide |
| PubChem CID | 11408185 |
| Molecular Formula | C24H19N3O4S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | N,2-dimethyl-6-[7-(1,3-thiazol-2-ylmethoxy)quinolin-4-yl]oxy-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(C)oc2cc(Oc3ccnc4cc(OCc5nccs5)ccc34)ccc12 |
| InChI | InChI=1S/C24H19N3O4S/c1-14-23(24(28)25-2)18-6-4-16(12-21(18)30-14)31-20-7-8-26-19-11-15(3-5-17(19)20)29-13-22-27-9-10-32-22/h3-12H,13H2,1-2H3,(H,25,28) |
| InChIKey | MDWIUOLFQXHACK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N,2-dimethyl-6-[7-(1,3-thiazol-2-ylmethoxy)quinolin-4-yl]oxy-1-benzofuran-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-6-[7-(1,3-thiazol-2-ylmethoxy)quinolin-4-yl]oxy-1-benzofuran-3-carboxamide?
The IUPAC name of N,2-dimethyl-6-[7-(1,3-thiazol-2-ylmethoxy)quinolin-4-yl]oxy-1-benzofuran-3-carboxamide (CID 11408185) is N,2-dimethyl-6-[7-(1,3-thiazol-2-ylmethoxy)quinolin-4-yl]oxy-1-benzofuran-3-carboxamide.
What is the SMILES notation for N,2-dimethyl-6-[7-(1,3-thiazol-2-ylmethoxy)quinolin-4-yl]oxy-1-benzofuran-3-carboxamide?
The canonical SMILES for N,2-dimethyl-6-[7-(1,3-thiazol-2-ylmethoxy)quinolin-4-yl]oxy-1-benzofuran-3-carboxamide is CNC(=O)c1c(C)oc2cc(Oc3ccnc4cc(OCc5nccs5)ccc34)ccc12.
What is the InChIKey of N,2-dimethyl-6-[7-(1,3-thiazol-2-ylmethoxy)quinolin-4-yl]oxy-1-benzofuran-3-carboxamide?
The InChIKey is MDWIUOLFQXHACK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19N3O4S/c1-14-23(24(28)25-2)18-6-4-16(12-21(18)30-14)31-20-7-8-26-19-11-15(3-5-17(19)20)29-13-22-27-9-10-32-22/h3-12H,13H2,1-2H3,(H,25,28).
What are the key properties of N,2-dimethyl-6-[7-(1,3-thiazol-2-ylmethoxy)quinolin-4-yl]oxy-1-benzofuran-3-carboxamide?
N,2-dimethyl-6-[7-(1,3-thiazol-2-ylmethoxy)quinolin-4-yl]oxy-1-benzofuran-3-carboxamide has a molecular weight of 445.50 g/mol, XLogP of 5.48, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-6-[7-(1,3-thiazol-2-ylmethoxy)quinolin-4-yl]oxy-1-benzofuran-3-carboxamide is sourced from PubChem (CID 11408185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).