C14H19IN2 — CID 114083159
(3aR,6aS)-5-[1-(4-iodophenyl)ethyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 114083159) has the molecular formula C14H19IN2 and a molecular weight of 342.22 g/mol. Its IUPAC name is (3aR,6aS)-5-[1-(4-iodophenyl)ethyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-5-[1-(4-iodophenyl)ethyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 114083159 |
| Molecular Formula | C14H19IN2 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | (3aR,6aS)-5-[1-(4-iodophenyl)ethyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CC(c1ccc(I)cc1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C14H19IN2/c1-10(11-2-4-14(15)5-3-11)17-8-12-6-16-7-13(12)9-17/h2-5,10,12-13,16H,6-9H2,1H3/t10?,12-,13+ |
| InChIKey | SOZFFHQVDSMCLA-VGPLMAKISA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|