C12H17BrN2O2S — CID 114083356
[2-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)phenyl]methanamine (PubChem CID 114083356) has the molecular formula C12H17BrN2O2S and a molecular weight of 333.25 g/mol. Its IUPAC name is [2-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)phenyl]methanamine.
| Compound Name | [2-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 114083356 |
| Molecular Formula | C12H17BrN2O2S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | [2-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)phenyl]methanamine |
| SMILES | NCc1ccc(N2CCCS(=O)(=O)CC2)cc1Br |
| InChI | InChI=1S/C12H17BrN2O2S/c13-12-8-11(3-2-10(12)9-14)15-4-1-6-18(16,17)7-5-15/h2-3,8H,1,4-7,9,14H2 |
| InChIKey | ZBYATWPBPYUVTO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |