C12H19N3O2S — CID 114083488
1-[5-(1,1-dioxo-1,4-thiazepan-4-yl)-2-pyridinyl]ethanamine (PubChem CID 114083488) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 1-[5-(1,1-dioxo-1,4-thiazepan-4-yl)-2-pyridinyl]ethanamine.
| Compound Name | 1-[5-(1,1-dioxo-1,4-thiazepan-4-yl)-2-pyridinyl]ethanamine |
|---|---|
| PubChem CID | 114083488 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-[5-(1,1-dioxo-1,4-thiazepan-4-yl)-2-pyridinyl]ethanamine |
| SMILES | CC(N)c1ccc(N2CCCS(=O)(=O)CC2)cn1 |
| InChI | InChI=1S/C12H19N3O2S/c1-10(13)12-4-3-11(9-14-12)15-5-2-7-18(16,17)8-6-15/h3-4,9-10H,2,5-8,13H2,1H3 |
| InChIKey | DHXXGGBFAUAWMM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |