About 2-(cyclopropylamino)-3-(1,1-dioxo-1,4-thiazepan-4-yl)propanoic acid
2-(cyclopropylamino)-3-(1,1-dioxo-1,4-thiazepan-4-yl)propanoic acid (PubChem CID 114083679) has the molecular formula C11H20N2O4S
and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-(cyclopropylamino)-3-(1,1-dioxo-1,4-thiazepan-4-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-(cyclopropylamino)-3-(1,1-dioxo-1,4-thiazepan-4-yl)propanoic acid |
| PubChem CID | 114083679 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-(cyclopropylamino)-3-(1,1-dioxo-1,4-thiazepan-4-yl)propanoic acid |
| SMILES | O=C(O)C(CN1CCCS(=O)(=O)CC1)NC1CC1 |
| InChI | InChI=1S/C11H20N2O4S/c14-11(15)10(12-9-2-3-9)8-13-4-1-6-18(16,17)7-5-13/h9-10,12H,1-8H2,(H,14,15) |
| InChIKey | BPJSVTXKQYLULE-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(cyclopropylamino)-3-(1,1-dioxo-1,4-thiazepan-4-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopropylamino)-3-(1,1-dioxo-1,4-thiazepan-4-yl)propanoic acid?
The IUPAC name of 2-(cyclopropylamino)-3-(1,1-dioxo-1,4-thiazepan-4-yl)propanoic acid (CID 114083679) is 2-(cyclopropylamino)-3-(1,1-dioxo-1,4-thiazepan-4-yl)propanoic acid.
What is the SMILES notation for 2-(cyclopropylamino)-3-(1,1-dioxo-1,4-thiazepan-4-yl)propanoic acid?
The canonical SMILES for 2-(cyclopropylamino)-3-(1,1-dioxo-1,4-thiazepan-4-yl)propanoic acid is O=C(O)C(CN1CCCS(=O)(=O)CC1)NC1CC1.
What is the InChIKey of 2-(cyclopropylamino)-3-(1,1-dioxo-1,4-thiazepan-4-yl)propanoic acid?
The InChIKey is BPJSVTXKQYLULE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O4S/c14-11(15)10(12-9-2-3-9)8-13-4-1-6-18(16,17)7-5-13/h9-10,12H,1-8H2,(H,14,15).
What are the key properties of 2-(cyclopropylamino)-3-(1,1-dioxo-1,4-thiazepan-4-yl)propanoic acid?
2-(cyclopropylamino)-3-(1,1-dioxo-1,4-thiazepan-4-yl)propanoic acid has a molecular weight of 276.36 g/mol, XLogP of -0.69, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopropylamino)-3-(1,1-dioxo-1,4-thiazepan-4-yl)propanoic acid is sourced from PubChem (CID 114083679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).