C14H24F5IN2O — CID 11408483
[(Z)-3-(diethylamino)-2-(2,2,3,3,3-pentafluoropropoxy)prop-2-enylidene]-diethylazanium iodide (PubChem CID 11408483) has the molecular formula C14H24F5IN2O and a molecular weight of 458.25 g/mol. Its IUPAC name is [(Z)-3-(diethylamino)-2-(2,2,3,3,3-pentafluoropropoxy)prop-2-enylidene]-diethylazanium iodide.
| Compound Name | [(Z)-3-(diethylamino)-2-(2,2,3,3,3-pentafluoropropoxy)prop-2-enylidene]-diethylazanium iodide |
|---|---|
| PubChem CID | 11408483 |
| Molecular Formula | C14H24F5IN2O |
| Molecular Weight | 458.25 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | [(Z)-3-(diethylamino)-2-(2,2,3,3,3-pentafluoropropoxy)prop-2-enylidene]-diethylazanium iodide |
| SMILES | CCN(/C=C(/C=[N+](CC)CC)OCC(F)(F)C(F)(F)F)CC.[I-] |
| InChI | InChI=1S/C14H24F5N2O.HI/c1-5-20(6-2)9-12(10-21(7-3)8-4)22-11-13(15,16)14(17,18)19;/h9-10H,5-8,11H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | OUWHRLRLNNZLOE-UHFFFAOYSA-M |
| XLogP | 0.51 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|