C30H38N2O2 — CID 11408499
1,5,5-trimethyl-3-[[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]methyl]imidazolidine-2,4-dione (PubChem CID 11408499) has the molecular formula C30H38N2O2 and a molecular weight of 458.65 g/mol. Its IUPAC name is 1,5,5-trimethyl-3-[[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]methyl]imidazolidine-2,4-dione.
| Compound Name | 1,5,5-trimethyl-3-[[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11408499 |
| Molecular Formula | C30H38N2O2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 1,5,5-trimethyl-3-[[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]methyl]imidazolidine-2,4-dione |
| SMILES | C=C(c1ccc(CN2C(=O)N(C)C(C)(C)C2=O)cc1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C30H38N2O2/c1-19-16-24-25(29(5,6)15-14-28(24,3)4)17-23(19)20(2)22-12-10-21(11-13-22)18-32-26(33)30(7,8)31(9)27(32)34/h10-13,16-17H,2,14-15,18H2,1,3-9H3 |
| InChIKey | OLYMDDFAYFLWAD-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|