C12H13ClN2O3 — CID 114085428
(3S,4S)-1-(6-chloropyridine-3-carbonyl)-4-methylpyrrolidine-3-carboxylic acid (PubChem CID 114085428) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is (3S,4S)-1-(6-chloropyridine-3-carbonyl)-4-methylpyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-(6-chloropyridine-3-carbonyl)-4-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 114085428 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | (3S,4S)-1-(6-chloropyridine-3-carbonyl)-4-methylpyrrolidine-3-carboxylic acid |
| SMILES | C[C@@H]1CN(C(=O)c2ccc(Cl)nc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C12H13ClN2O3/c1-7-5-15(6-9(7)12(17)18)11(16)8-2-3-10(13)14-4-8/h2-4,7,9H,5-6H2,1H3,(H,17,18)/t7-,9-/m1/s1 |
| InChIKey | XQEHRVVHSXMGOR-VXNVDRBHSA-N |
| XLogP | 1.53 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|