C11H17N5S — CID 114086676
2-(2,4-dimethylpiperazin-1-yl)pyrimidine-4-carbothioamide (PubChem CID 114086676) has the molecular formula C11H17N5S and a molecular weight of 251.36 g/mol. Its IUPAC name is 2-(2,4-dimethylpiperazin-1-yl)pyrimidine-4-carbothioamide.
| Compound Name | 2-(2,4-dimethylpiperazin-1-yl)pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 114086676 |
| Molecular Formula | C11H17N5S |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-(2,4-dimethylpiperazin-1-yl)pyrimidine-4-carbothioamide |
| SMILES | CC1CN(C)CCN1c1nccc(C(N)=S)n1 |
| InChI | InChI=1S/C11H17N5S/c1-8-7-15(2)5-6-16(8)11-13-4-3-9(14-11)10(12)17/h3-4,8H,5-7H2,1-2H3,(H2,12,17) |
| InChIKey | FHJBSZDXCISCSA-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|