C14H18BrN3 — CID 114086783
3-bromo-5-(2,4-dimethyl-1,4-diazepan-1-yl)benzonitrile (PubChem CID 114086783) has the molecular formula C14H18BrN3 and a molecular weight of 308.22 g/mol. Its IUPAC name is 3-bromo-5-(2,4-dimethyl-1,4-diazepan-1-yl)benzonitrile.
| Compound Name | 3-bromo-5-(2,4-dimethyl-1,4-diazepan-1-yl)benzonitrile |
|---|---|
| PubChem CID | 114086783 |
| Molecular Formula | C14H18BrN3 |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 3-bromo-5-(2,4-dimethyl-1,4-diazepan-1-yl)benzonitrile |
| SMILES | CC1CN(C)CCCN1c1cc(Br)cc(C#N)c1 |
| InChI | InChI=1S/C14H18BrN3/c1-11-10-17(2)4-3-5-18(11)14-7-12(9-16)6-13(15)8-14/h6-8,11H,3-5,10H2,1-2H3 |
| InChIKey | AOLZNLSWXKBZIC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |