C14H23N3O — CID 114087398
(1R)-1-[5-(2,4-dimethylpiperazin-1-yl)-2-pyridinyl]propan-1-ol (PubChem CID 114087398) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is (1R)-1-[5-(2,4-dimethylpiperazin-1-yl)-2-pyridinyl]propan-1-ol.
| Compound Name | (1R)-1-[5-(2,4-dimethylpiperazin-1-yl)-2-pyridinyl]propan-1-ol |
|---|---|
| PubChem CID | 114087398 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | (1R)-1-[5-(2,4-dimethylpiperazin-1-yl)-2-pyridinyl]propan-1-ol |
| SMILES | CC[C@@H](O)c1ccc(N2CCN(C)CC2C)cn1 |
| InChI | InChI=1S/C14H23N3O/c1-4-14(18)13-6-5-12(9-15-13)17-8-7-16(3)10-11(17)2/h5-6,9,11,14,18H,4,7-8,10H2,1-3H3/t11?,14-/m1/s1 |
| InChIKey | MNIFHXMYPMELHA-SBXXRYSUSA-N |
| XLogP | 1.67 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |