About (5-amino-1-methylpyrazol-4-yl)-(2,4-dimethyl-1,4-diazepan-1-yl)methanone
(5-amino-1-methylpyrazol-4-yl)-(2,4-dimethyl-1,4-diazepan-1-yl)methanone (PubChem CID 114087644) has the molecular formula C12H21N5O
and a molecular weight of 251.33 g/mol. Its IUPAC name is (5-amino-1-methylpyrazol-4-yl)-(2,4-dimethyl-1,4-diazepan-1-yl)methanone.
Molecular Properties
| Compound Name | (5-amino-1-methylpyrazol-4-yl)-(2,4-dimethyl-1,4-diazepan-1-yl)methanone |
| PubChem CID | 114087644 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (5-amino-1-methylpyrazol-4-yl)-(2,4-dimethyl-1,4-diazepan-1-yl)methanone |
| SMILES | CC1CN(C)CCCN1C(=O)c1cnn(C)c1N |
| InChI | InChI=1S/C12H21N5O/c1-9-8-15(2)5-4-6-17(9)12(18)10-7-14-16(3)11(10)13/h7,9H,4-6,8,13H2,1-3H3 |
| InChIKey | DSUDETFDRSXHSI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-amino-1-methylpyrazol-4-yl)-(2,4-dimethyl-1,4-diazepan-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-1-methylpyrazol-4-yl)-(2,4-dimethyl-1,4-diazepan-1-yl)methanone?
The IUPAC name of (5-amino-1-methylpyrazol-4-yl)-(2,4-dimethyl-1,4-diazepan-1-yl)methanone (CID 114087644) is (5-amino-1-methylpyrazol-4-yl)-(2,4-dimethyl-1,4-diazepan-1-yl)methanone.
What is the SMILES notation for (5-amino-1-methylpyrazol-4-yl)-(2,4-dimethyl-1,4-diazepan-1-yl)methanone?
The canonical SMILES for (5-amino-1-methylpyrazol-4-yl)-(2,4-dimethyl-1,4-diazepan-1-yl)methanone is CC1CN(C)CCCN1C(=O)c1cnn(C)c1N.
What is the InChIKey of (5-amino-1-methylpyrazol-4-yl)-(2,4-dimethyl-1,4-diazepan-1-yl)methanone?
The InChIKey is DSUDETFDRSXHSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5O/c1-9-8-15(2)5-4-6-17(9)12(18)10-7-14-16(3)11(10)13/h7,9H,4-6,8,13H2,1-3H3.
What are the key properties of (5-amino-1-methylpyrazol-4-yl)-(2,4-dimethyl-1,4-diazepan-1-yl)methanone?
(5-amino-1-methylpyrazol-4-yl)-(2,4-dimethyl-1,4-diazepan-1-yl)methanone has a molecular weight of 251.33 g/mol, XLogP of 0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-1-methylpyrazol-4-yl)-(2,4-dimethyl-1,4-diazepan-1-yl)methanone is sourced from PubChem (CID 114087644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).