C25H31N3O4S — CID 11408780
(1S,5R,6R)-8-benzyl-6-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-4-methylidene-3,8-diazabicyclo[3.2.1]octan-2-one (PubChem CID 11408780) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is (1S,5R,6R)-8-benzyl-6-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-4-methylidene-3,8-diazabicyclo[3.2.1]octan-2-one.
| Compound Name | (1S,5R,6R)-8-benzyl-6-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-4-methylidene-3,8-diazabicyclo[3.2.1]octan-2-one |
|---|---|
| PubChem CID | 11408780 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | (1S,5R,6R)-8-benzyl-6-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-4-methylidene-3,8-diazabicyclo[3.2.1]octan-2-one |
| SMILES | C=C1NC(=O)[C@@H]2C[C@@H](C(=O)N3[C@H]4C[C@@H]5CC[C@@]4(CS3(=O)=O)C5(C)C)[C@H]1N2Cc1ccccc1 |
| InChI | InChI=1S/C25H31N3O4S/c1-15-21-18(12-19(22(29)26-15)27(21)13-16-7-5-4-6-8-16)23(30)28-20-11-17-9-10-25(20,24(17,2)3)14-33(28,31)32/h4-8,17-21H,1,9-14H2,2-3H3,(H,26,29)/t17-,18+,19-,20-,21-,25-/m0/s1 |
| InChIKey | BJIKTEYVWVEUNS-FWGIFVSCSA-N |
| XLogP | 2.26 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |