C13H29N3O — CID 114087888
4-(2,4-dimethylpiperazin-1-yl)-N-(2-methoxyethyl)butan-1-amine (PubChem CID 114087888) has the molecular formula C13H29N3O and a molecular weight of 243.39 g/mol. Its IUPAC name is 4-(2,4-dimethylpiperazin-1-yl)-N-(2-methoxyethyl)butan-1-amine.
| Compound Name | 4-(2,4-dimethylpiperazin-1-yl)-N-(2-methoxyethyl)butan-1-amine |
|---|---|
| PubChem CID | 114087888 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | 4-(2,4-dimethylpiperazin-1-yl)-N-(2-methoxyethyl)butan-1-amine |
| SMILES | COCCNCCCCN1CCN(C)CC1C |
| InChI | InChI=1S/C13H29N3O/c1-13-12-15(2)9-10-16(13)8-5-4-6-14-7-11-17-3/h13-14H,4-12H2,1-3H3 |
| InChIKey | RGYFUFTZFJKDDB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|