C20H29F3N6O4 — CID 11408875
N-[[4,4-dimethyl-1-[[[4-morpholin-4-yl-6-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]cyclohexyl]methyl]-N-hydroxyformamide (PubChem CID 11408875) has the molecular formula C20H29F3N6O4 and a molecular weight of 474.48 g/mol. Its IUPAC name is N-[[4,4-dimethyl-1-[[[4-morpholin-4-yl-6-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]cyclohexyl]methyl]-N-hydroxyformamide.
| Compound Name | N-[[4,4-dimethyl-1-[[[4-morpholin-4-yl-6-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]cyclohexyl]methyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 11408875 |
| Molecular Formula | C20H29F3N6O4 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | N-[[4,4-dimethyl-1-[[[4-morpholin-4-yl-6-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]cyclohexyl]methyl]-N-hydroxyformamide |
| SMILES | CC1(C)CCC(CN(O)C=O)(C(=O)NNc2nc(N3CCOCC3)cc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C20H29F3N6O4/c1-18(2)3-5-19(6-4-18,12-29(32)13-30)16(31)26-27-17-24-14(20(21,22)23)11-15(25-17)28-7-9-33-10-8-28/h11,13,32H,3-10,12H2,1-2H3,(H,26,31)(H,24,25,27) |
| InChIKey | LMBRFGZZQCAUKE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|