About 1-(2-amino-5-chloro-4-fluorophenyl)imidazole-4,5-dicarbonitrile
1-(2-amino-5-chloro-4-fluorophenyl)imidazole-4,5-dicarbonitrile (PubChem CID 114089127) has the molecular formula C11H5ClFN5
and a molecular weight of 261.65 g/mol. Its IUPAC name is 1-(2-amino-5-chloro-4-fluorophenyl)imidazole-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 1-(2-amino-5-chloro-4-fluorophenyl)imidazole-4,5-dicarbonitrile |
| PubChem CID | 114089127 |
| Molecular Formula | C11H5ClFN5 |
| Molecular Weight | 261.65 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 1-(2-amino-5-chloro-4-fluorophenyl)imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1ncn(-c2cc(Cl)c(F)cc2N)c1C#N |
| InChI | InChI=1S/C11H5ClFN5/c12-6-1-10(8(16)2-7(6)13)18-5-17-9(3-14)11(18)4-15/h1-2,5H,16H2 |
| InChIKey | SBUKKGNBFBXKPL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.65 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-amino-5-chloro-4-fluorophenyl)imidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-5-chloro-4-fluorophenyl)imidazole-4,5-dicarbonitrile?
The IUPAC name of 1-(2-amino-5-chloro-4-fluorophenyl)imidazole-4,5-dicarbonitrile (CID 114089127) is 1-(2-amino-5-chloro-4-fluorophenyl)imidazole-4,5-dicarbonitrile.
What is the SMILES notation for 1-(2-amino-5-chloro-4-fluorophenyl)imidazole-4,5-dicarbonitrile?
The canonical SMILES for 1-(2-amino-5-chloro-4-fluorophenyl)imidazole-4,5-dicarbonitrile is N#Cc1ncn(-c2cc(Cl)c(F)cc2N)c1C#N.
What is the InChIKey of 1-(2-amino-5-chloro-4-fluorophenyl)imidazole-4,5-dicarbonitrile?
The InChIKey is SBUKKGNBFBXKPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5ClFN5/c12-6-1-10(8(16)2-7(6)13)18-5-17-9(3-14)11(18)4-15/h1-2,5H,16H2.
What are the key properties of 1-(2-amino-5-chloro-4-fluorophenyl)imidazole-4,5-dicarbonitrile?
1-(2-amino-5-chloro-4-fluorophenyl)imidazole-4,5-dicarbonitrile has a molecular weight of 261.65 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-5-chloro-4-fluorophenyl)imidazole-4,5-dicarbonitrile is sourced from PubChem (CID 114089127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).