C23H23N5O7 — CID 11409034
[(2S,3R,4S)-4-[2-(cyanoamino)benzimidazol-1-yl]-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-yl] acetate (PubChem CID 11409034) has the molecular formula C23H23N5O7 and a molecular weight of 481.47 g/mol. Its IUPAC name is [(2S,3R,4S)-4-[2-(cyanoamino)benzimidazol-1-yl]-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-yl] acetate.
| Compound Name | [(2S,3R,4S)-4-[2-(cyanoamino)benzimidazol-1-yl]-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-yl] acetate |
|---|---|
| PubChem CID | 11409034 |
| Molecular Formula | C23H23N5O7 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | [(2S,3R,4S)-4-[2-(cyanoamino)benzimidazol-1-yl]-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-yl] acetate |
| SMILES | COC(OC)[C@@]1(C)Oc2ccc([N+](=O)[O-])cc2[C@H](n2c(NC#N)nc3ccccc32)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H23N5O7/c1-13(29)34-20-19(27-17-8-6-5-7-16(17)26-22(27)25-12-24)15-11-14(28(30)31)9-10-18(15)35-23(20,2)21(32-3)33-4/h5-11,19-21H,1-4H3,(H,25,26)/t19-,20+,23-/m0/s1 |
| InChIKey | XKPWICHIZJLXTB-MZKRTTBSSA-N |
| XLogP | 3.13 |
| TPSA | 150.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|