C14H22N4O — CID 114090347
5-amino-2-[(4-methylcyclohexyl)methylamino]pyridine-4-carboxamide (PubChem CID 114090347) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 5-amino-2-[(4-methylcyclohexyl)methylamino]pyridine-4-carboxamide.
| Compound Name | 5-amino-2-[(4-methylcyclohexyl)methylamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114090347 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 5-amino-2-[(4-methylcyclohexyl)methylamino]pyridine-4-carboxamide |
| SMILES | CC1CCC(CNc2cc(C(N)=O)c(N)cn2)CC1 |
| InChI | InChI=1S/C14H22N4O/c1-9-2-4-10(5-3-9)7-17-13-6-11(14(16)19)12(15)8-18-13/h6,8-10H,2-5,7,15H2,1H3,(H2,16,19)(H,17,18) |
| InChIKey | CHMYBVHGIQVKFX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |