C11H14N2O5 — CID 114092529
cis-(1R,3S)-3-(3,5-dioxopiperazine-1-carbonyl)-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 114092529) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is cis-(1R,3S)-3-(3,5-dioxopiperazine-1-carbonyl)-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-(3,5-dioxopiperazine-1-carbonyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 114092529 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | cis-(1R,3S)-3-(3,5-dioxopiperazine-1-carbonyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)[C@@H]1C(=O)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C11H14N2O5/c1-11(2)7(8(11)10(17)18)9(16)13-3-5(14)12-6(15)4-13/h7-8H,3-4H2,1-2H3,(H,17,18)(H,12,14,15)/t7-,8+/m1/s1 |
| InChIKey | XBYRRJBBRPVKJF-SFYZADRCSA-N |
| XLogP | -1.17 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|