C20H22ClF5N6O — CID 11409275
[4-chloro-5-[4-[4-(dimethylamino)butoxy]-2,6-difluorophenyl]-6-(2,2,2-trifluoroethylamino)pyrimidin-2-yl]-methylcyanamide (PubChem CID 11409275) has the molecular formula C20H22ClF5N6O and a molecular weight of 492.88 g/mol. Its IUPAC name is [4-chloro-5-[4-[4-(dimethylamino)butoxy]-2,6-difluorophenyl]-6-(2,2,2-trifluoroethylamino)pyrimidin-2-yl]-methylcyanamide.
| Compound Name | [4-chloro-5-[4-[4-(dimethylamino)butoxy]-2,6-difluorophenyl]-6-(2,2,2-trifluoroethylamino)pyrimidin-2-yl]-methylcyanamide |
|---|---|
| PubChem CID | 11409275 |
| Molecular Formula | C20H22ClF5N6O |
| Molecular Weight | 492.88 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | [4-chloro-5-[4-[4-(dimethylamino)butoxy]-2,6-difluorophenyl]-6-(2,2,2-trifluoroethylamino)pyrimidin-2-yl]-methylcyanamide |
| SMILES | CN(C)CCCCOc1cc(F)c(-c2c(Cl)nc(N(C)C#N)nc2NCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C20H22ClF5N6O/c1-31(2)6-4-5-7-33-12-8-13(22)15(14(23)9-12)16-17(21)29-19(32(3)11-27)30-18(16)28-10-20(24,25)26/h8-9H,4-7,10H2,1-3H3,(H,28,29,30) |
| InChIKey | MQQNODRQFDMVEW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 77.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.88 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|