C10H14F2N2O3S — CID 114092918
1-(3-aminophenyl)-N-(3,3-difluoro-2-hydroxypropyl)methanesulfonamide (PubChem CID 114092918) has the molecular formula C10H14F2N2O3S and a molecular weight of 280.30 g/mol. Its IUPAC name is 1-(3-aminophenyl)-N-(3,3-difluoro-2-hydroxypropyl)methanesulfonamide.
| Compound Name | 1-(3-aminophenyl)-N-(3,3-difluoro-2-hydroxypropyl)methanesulfonamide |
|---|---|
| PubChem CID | 114092918 |
| Molecular Formula | C10H14F2N2O3S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 1-(3-aminophenyl)-N-(3,3-difluoro-2-hydroxypropyl)methanesulfonamide |
| SMILES | Nc1cccc(CS(=O)(=O)NCC(O)C(F)F)c1 |
| InChI | InChI=1S/C10H14F2N2O3S/c11-10(12)9(15)5-14-18(16,17)6-7-2-1-3-8(13)4-7/h1-4,9-10,14-15H,5-6,13H2 |
| InChIKey | DQWUNRJMRWOEPK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|