About 5-bromo-4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]furan-2-carboxylic acid
5-bromo-4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]furan-2-carboxylic acid (PubChem CID 114093090) has the molecular formula C8H8BrF2NO6S
and a molecular weight of 364.12 g/mol. Its IUPAC name is 5-bromo-4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]furan-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-bromo-4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]furan-2-carboxylic acid |
| PubChem CID | 114093090 |
| Molecular Formula | C8H8BrF2NO6S |
| Molecular Weight | 364.12 g/mol |
| Exact Mass | 362.92 |
| IUPAC Name | 5-bromo-4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCC(O)C(F)F)c(Br)o1 |
| InChI | InChI=1S/C8H8BrF2NO6S/c9-6-5(1-4(18-6)8(14)15)19(16,17)12-2-3(13)7(10)11/h1,3,7,12-13H,2H2,(H,14,15) |
| InChIKey | UWHRYDVYUWMJQA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.12 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]furan-2-carboxylic acid?
The IUPAC name of 5-bromo-4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]furan-2-carboxylic acid (CID 114093090) is 5-bromo-4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]furan-2-carboxylic acid.
What is the SMILES notation for 5-bromo-4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]furan-2-carboxylic acid?
The canonical SMILES for 5-bromo-4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]furan-2-carboxylic acid is O=C(O)c1cc(S(=O)(=O)NCC(O)C(F)F)c(Br)o1.
What is the InChIKey of 5-bromo-4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]furan-2-carboxylic acid?
The InChIKey is UWHRYDVYUWMJQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrF2NO6S/c9-6-5(1-4(18-6)8(14)15)19(16,17)12-2-3(13)7(10)11/h1,3,7,12-13H,2H2,(H,14,15).
What are the key properties of 5-bromo-4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]furan-2-carboxylic acid?
5-bromo-4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]furan-2-carboxylic acid has a molecular weight of 364.12 g/mol, XLogP of 0.64, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]furan-2-carboxylic acid is sourced from PubChem (CID 114093090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).