About 2-[5-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]thiophen-2-yl]acetic acid
2-[5-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]thiophen-2-yl]acetic acid (PubChem CID 114093118) has the molecular formula C10H12F3NO3S
and a molecular weight of 283.27 g/mol. Its IUPAC name is 2-[5-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]thiophen-2-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[5-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]thiophen-2-yl]acetic acid |
| PubChem CID | 114093118 |
| Molecular Formula | C10H12F3NO3S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-[5-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]thiophen-2-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CNCC(O)C(F)(F)F)s1 |
| InChI | InChI=1S/C10H12F3NO3S/c11-10(12,13)8(15)5-14-4-7-2-1-6(18-7)3-9(16)17/h1-2,8,14-15H,3-5H2,(H,16,17) |
| InChIKey | PEEQECRYJCPKNJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]thiophen-2-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]thiophen-2-yl]acetic acid?
The IUPAC name of 2-[5-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]thiophen-2-yl]acetic acid (CID 114093118) is 2-[5-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]thiophen-2-yl]acetic acid.
What is the SMILES notation for 2-[5-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]thiophen-2-yl]acetic acid?
The canonical SMILES for 2-[5-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]thiophen-2-yl]acetic acid is O=C(O)Cc1ccc(CNCC(O)C(F)(F)F)s1.
What is the InChIKey of 2-[5-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]thiophen-2-yl]acetic acid?
The InChIKey is PEEQECRYJCPKNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F3NO3S/c11-10(12,13)8(15)5-14-4-7-2-1-6(18-7)3-9(16)17/h1-2,8,14-15H,3-5H2,(H,16,17).
What are the key properties of 2-[5-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]thiophen-2-yl]acetic acid?
2-[5-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]thiophen-2-yl]acetic acid has a molecular weight of 283.27 g/mol, XLogP of 1.39, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]thiophen-2-yl]acetic acid is sourced from PubChem (CID 114093118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).