C12H20F3NO — CID 114093237
3-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-1,1,1-trifluoropropan-2-ol (PubChem CID 114093237) has the molecular formula C12H20F3NO and a molecular weight of 251.29 g/mol. Its IUPAC name is 3-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 114093237 |
| Molecular Formula | C12H20F3NO |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 3-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC1=CC(C)CC(CNCC(O)C(F)(F)F)C1 |
| InChI | InChI=1S/C12H20F3NO/c1-8-3-9(2)5-10(4-8)6-16-7-11(17)12(13,14)15/h3,8,10-11,16-17H,4-7H2,1-2H3 |
| InChIKey | QIRJINAQNOLMKR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|