C11H19F3N2O — CID 114093391
2,2-dimethyl-6-[(3,3,3-trifluoro-2-hydroxypropyl)amino]hexanenitrile (PubChem CID 114093391) has the molecular formula C11H19F3N2O and a molecular weight of 252.28 g/mol. Its IUPAC name is 2,2-dimethyl-6-[(3,3,3-trifluoro-2-hydroxypropyl)amino]hexanenitrile.
| Compound Name | 2,2-dimethyl-6-[(3,3,3-trifluoro-2-hydroxypropyl)amino]hexanenitrile |
|---|---|
| PubChem CID | 114093391 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2,2-dimethyl-6-[(3,3,3-trifluoro-2-hydroxypropyl)amino]hexanenitrile |
| SMILES | CC(C)(C#N)CCCCNCC(O)C(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O/c1-10(2,8-15)5-3-4-6-16-7-9(17)11(12,13)14/h9,16-17H,3-7H2,1-2H3 |
| InChIKey | IMLPSSFKERXJHN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|