C28H56O3Si2 — CID 11409360
[(4aR,5S,6R,8aR)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5,8a-dimethyl-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methanol (PubChem CID 11409360) has the molecular formula C28H56O3Si2 and a molecular weight of 496.93 g/mol. Its IUPAC name is [(4aR,5S,6R,8aR)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5,8a-dimethyl-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methanol.
| Compound Name | [(4aR,5S,6R,8aR)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5,8a-dimethyl-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methanol |
|---|---|
| PubChem CID | 11409360 |
| Molecular Formula | C28H56O3Si2 |
| Molecular Weight | 496.93 g/mol |
| Exact Mass | 496.38 |
| IUPAC Name | [(4aR,5S,6R,8aR)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5,8a-dimethyl-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methanol |
| SMILES | CC[Si](CC)(CC)O[C@@H]1CC[C@]2(C)C=C(CO)CC[C@H]2[C@]1(C)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H56O3Si2/c1-11-33(12-2,13-3)31-25-17-19-27(7)21-23(22-29)15-16-24(27)28(25,8)18-14-20-30-32(9,10)26(4,5)6/h21,24-25,29H,11-20,22H2,1-10H3/t24-,25-,27-,28+/m1/s1 |
| InChIKey | XHBHFBMJEPAWPY-KECVVUEUSA-N |
| XLogP | 8.31 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.93 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|