About 4-(3,3-difluorocyclopentanecarbonyl)-3-ethylpiperazin-2-one
4-(3,3-difluorocyclopentanecarbonyl)-3-ethylpiperazin-2-one (PubChem CID 114094362) has the molecular formula C12H18F2N2O2
and a molecular weight of 260.28 g/mol. Its IUPAC name is 4-(3,3-difluorocyclopentanecarbonyl)-3-ethylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-(3,3-difluorocyclopentanecarbonyl)-3-ethylpiperazin-2-one |
| PubChem CID | 114094362 |
| Molecular Formula | C12H18F2N2O2 |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 4-(3,3-difluorocyclopentanecarbonyl)-3-ethylpiperazin-2-one |
| SMILES | CCC1C(=O)NCCN1C(=O)C1CCC(F)(F)C1 |
| InChI | InChI=1S/C12H18F2N2O2/c1-2-9-10(17)15-5-6-16(9)11(18)8-3-4-12(13,14)7-8/h8-9H,2-7H2,1H3,(H,15,17) |
| InChIKey | FATLXKWBFYDHBL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,3-difluorocyclopentanecarbonyl)-3-ethylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-difluorocyclopentanecarbonyl)-3-ethylpiperazin-2-one?
The IUPAC name of 4-(3,3-difluorocyclopentanecarbonyl)-3-ethylpiperazin-2-one (CID 114094362) is 4-(3,3-difluorocyclopentanecarbonyl)-3-ethylpiperazin-2-one.
What is the SMILES notation for 4-(3,3-difluorocyclopentanecarbonyl)-3-ethylpiperazin-2-one?
The canonical SMILES for 4-(3,3-difluorocyclopentanecarbonyl)-3-ethylpiperazin-2-one is CCC1C(=O)NCCN1C(=O)C1CCC(F)(F)C1.
What is the InChIKey of 4-(3,3-difluorocyclopentanecarbonyl)-3-ethylpiperazin-2-one?
The InChIKey is FATLXKWBFYDHBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2N2O2/c1-2-9-10(17)15-5-6-16(9)11(18)8-3-4-12(13,14)7-8/h8-9H,2-7H2,1H3,(H,15,17).
What are the key properties of 4-(3,3-difluorocyclopentanecarbonyl)-3-ethylpiperazin-2-one?
4-(3,3-difluorocyclopentanecarbonyl)-3-ethylpiperazin-2-one has a molecular weight of 260.28 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-difluorocyclopentanecarbonyl)-3-ethylpiperazin-2-one is sourced from PubChem (CID 114094362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).