About N-cyclobutyl-3,3-difluoro-N-(2-hydroxyethyl)cyclopentane-1-carboxamide
N-cyclobutyl-3,3-difluoro-N-(2-hydroxyethyl)cyclopentane-1-carboxamide (PubChem CID 114094514) has the molecular formula C12H19F2NO2
and a molecular weight of 247.28 g/mol. Its IUPAC name is N-cyclobutyl-3,3-difluoro-N-(2-hydroxyethyl)cyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | N-cyclobutyl-3,3-difluoro-N-(2-hydroxyethyl)cyclopentane-1-carboxamide |
| PubChem CID | 114094514 |
| Molecular Formula | C12H19F2NO2 |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-cyclobutyl-3,3-difluoro-N-(2-hydroxyethyl)cyclopentane-1-carboxamide |
| SMILES | O=C(C1CCC(F)(F)C1)N(CCO)C1CCC1 |
| InChI | InChI=1S/C12H19F2NO2/c13-12(14)5-4-9(8-12)11(17)15(6-7-16)10-2-1-3-10/h9-10,16H,1-8H2 |
| InChIKey | YEUPWDMSTFGIST-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclobutyl-3,3-difluoro-N-(2-hydroxyethyl)cyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclobutyl-3,3-difluoro-N-(2-hydroxyethyl)cyclopentane-1-carboxamide?
The IUPAC name of N-cyclobutyl-3,3-difluoro-N-(2-hydroxyethyl)cyclopentane-1-carboxamide (CID 114094514) is N-cyclobutyl-3,3-difluoro-N-(2-hydroxyethyl)cyclopentane-1-carboxamide.
What is the SMILES notation for N-cyclobutyl-3,3-difluoro-N-(2-hydroxyethyl)cyclopentane-1-carboxamide?
The canonical SMILES for N-cyclobutyl-3,3-difluoro-N-(2-hydroxyethyl)cyclopentane-1-carboxamide is O=C(C1CCC(F)(F)C1)N(CCO)C1CCC1.
What is the InChIKey of N-cyclobutyl-3,3-difluoro-N-(2-hydroxyethyl)cyclopentane-1-carboxamide?
The InChIKey is YEUPWDMSTFGIST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F2NO2/c13-12(14)5-4-9(8-12)11(17)15(6-7-16)10-2-1-3-10/h9-10,16H,1-8H2.
What are the key properties of N-cyclobutyl-3,3-difluoro-N-(2-hydroxyethyl)cyclopentane-1-carboxamide?
N-cyclobutyl-3,3-difluoro-N-(2-hydroxyethyl)cyclopentane-1-carboxamide has a molecular weight of 247.28 g/mol, XLogP of 1.80, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclobutyl-3,3-difluoro-N-(2-hydroxyethyl)cyclopentane-1-carboxamide is sourced from PubChem (CID 114094514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).