C15H21BrClN — CID 114094772
1-(2-bromo-5-chlorophenyl)-N-[(1-methylcyclohexyl)methyl]methanamine (PubChem CID 114094772) has the molecular formula C15H21BrClN and a molecular weight of 330.70 g/mol. Its IUPAC name is 1-(2-bromo-5-chlorophenyl)-N-[(1-methylcyclohexyl)methyl]methanamine.
| Compound Name | 1-(2-bromo-5-chlorophenyl)-N-[(1-methylcyclohexyl)methyl]methanamine |
|---|---|
| PubChem CID | 114094772 |
| Molecular Formula | C15H21BrClN |
| Molecular Weight | 330.70 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 1-(2-bromo-5-chlorophenyl)-N-[(1-methylcyclohexyl)methyl]methanamine |
| SMILES | CC1(CNCc2cc(Cl)ccc2Br)CCCCC1 |
| InChI | InChI=1S/C15H21BrClN/c1-15(7-3-2-4-8-15)11-18-10-12-9-13(17)5-6-14(12)16/h5-6,9,18H,2-4,7-8,10-11H2,1H3 |
| InChIKey | QRFNLEXMYDMSMU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.70 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |