C31H54O3Si — CID 11409487
tert-butyl-[(2R,3E,5E,8R,9Z,11E)-10-ethyl-2,4,8-trimethyl-12-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]dodeca-3,5,9,11-tetraenoxy]-dimethylsilane (PubChem CID 11409487) has the molecular formula C31H54O3Si and a molecular weight of 502.86 g/mol. Its IUPAC name is tert-butyl-[(2R,3E,5E,8R,9Z,11E)-10-ethyl-2,4,8-trimethyl-12-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]dodeca-3,5,9,11-tetraenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3E,5E,8R,9Z,11E)-10-ethyl-2,4,8-trimethyl-12-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]dodeca-3,5,9,11-tetraenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11409487 |
| Molecular Formula | C31H54O3Si |
| Molecular Weight | 502.86 g/mol |
| Exact Mass | 502.38 |
| IUPAC Name | tert-butyl-[(2R,3E,5E,8R,9Z,11E)-10-ethyl-2,4,8-trimethyl-12-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]dodeca-3,5,9,11-tetraenoxy]-dimethylsilane |
| SMILES | CCC(=C/[C@H](C)C/C=C/C(C)=C/[C@@H](C)CO[Si](C)(C)C(C)(C)C)/C=C/[C@H]1CC=C[C@H](OC(C)C)O1 |
| InChI | InChI=1S/C31H54O3Si/c1-12-28(19-20-29-17-14-18-30(34-29)33-24(2)3)22-26(5)16-13-15-25(4)21-27(6)23-32-35(10,11)31(7,8)9/h13-15,18-22,24,26-27,29-30H,12,16-17,23H2,1-11H3/b15-13+,20-19+,25-21+,28-22-/t26-,27-,29-,30-/m1/s1 |
| InChIKey | BAWAGBBKALDLMF-VRNDFBBJSA-N |
| XLogP | 9.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.86 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|