About N-[(2-methylphenyl)methyl]tricyclo[3.2.1.02,4]octan-3-amine
N-[(2-methylphenyl)methyl]tricyclo[3.2.1.02,4]octan-3-amine (PubChem CID 114095751) has the molecular formula C16H21N
and a molecular weight of 227.35 g/mol. Its IUPAC name is N-[(2-methylphenyl)methyl]tricyclo[3.2.1.02,4]octan-3-amine.
Analyze N-[(2-methylphenyl)methyl]tricyclo[3.2.1.02,4]octan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-methylphenyl)methyl]tricyclo[3.2.1.02,4]octan-3-amine?
The IUPAC name of N-[(2-methylphenyl)methyl]tricyclo[3.2.1.02,4]octan-3-amine (CID 114095751) is N-[(2-methylphenyl)methyl]tricyclo[3.2.1.02,4]octan-3-amine.
What is the SMILES notation for N-[(2-methylphenyl)methyl]tricyclo[3.2.1.02,4]octan-3-amine?
The canonical SMILES for N-[(2-methylphenyl)methyl]tricyclo[3.2.1.02,4]octan-3-amine is Cc1ccccc1CNC1C2C3CCC(C3)C12.
What is the InChIKey of N-[(2-methylphenyl)methyl]tricyclo[3.2.1.02,4]octan-3-amine?
The InChIKey is PPXFRWSXDNHICC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N/c1-10-4-2-3-5-13(10)9-17-16-14-11-6-7-12(8-11)15(14)16/h2-5,11-12,14-17H,6-9H2,1H3.
What are the key properties of N-[(2-methylphenyl)methyl]tricyclo[3.2.1.02,4]octan-3-amine?
N-[(2-methylphenyl)methyl]tricyclo[3.2.1.02,4]octan-3-amine has a molecular weight of 227.35 g/mol, XLogP of 3.13, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-methylphenyl)methyl]tricyclo[3.2.1.02,4]octan-3-amine is sourced from PubChem (CID 114095751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).