About 6-chloro-N-(2,3-dimethyloxolan-3-yl)-2-ethyl-5-methylpyrimidin-4-amine
6-chloro-N-(2,3-dimethyloxolan-3-yl)-2-ethyl-5-methylpyrimidin-4-amine (PubChem CID 114096231) has the molecular formula C13H20ClN3O
and a molecular weight of 269.78 g/mol. Its IUPAC name is 6-chloro-N-(2,3-dimethyloxolan-3-yl)-2-ethyl-5-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-chloro-N-(2,3-dimethyloxolan-3-yl)-2-ethyl-5-methylpyrimidin-4-amine |
| PubChem CID | 114096231 |
| Molecular Formula | C13H20ClN3O |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 6-chloro-N-(2,3-dimethyloxolan-3-yl)-2-ethyl-5-methylpyrimidin-4-amine |
| SMILES | CCc1nc(Cl)c(C)c(NC2(C)CCOC2C)n1 |
| InChI | InChI=1S/C13H20ClN3O/c1-5-10-15-11(14)8(2)12(16-10)17-13(4)6-7-18-9(13)3/h9H,5-7H2,1-4H3,(H,15,16,17) |
| InChIKey | JLAWQNFBLKAHFJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-N-(2,3-dimethyloxolan-3-yl)-2-ethyl-5-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(2,3-dimethyloxolan-3-yl)-2-ethyl-5-methylpyrimidin-4-amine?
The IUPAC name of 6-chloro-N-(2,3-dimethyloxolan-3-yl)-2-ethyl-5-methylpyrimidin-4-amine (CID 114096231) is 6-chloro-N-(2,3-dimethyloxolan-3-yl)-2-ethyl-5-methylpyrimidin-4-amine.
What is the SMILES notation for 6-chloro-N-(2,3-dimethyloxolan-3-yl)-2-ethyl-5-methylpyrimidin-4-amine?
The canonical SMILES for 6-chloro-N-(2,3-dimethyloxolan-3-yl)-2-ethyl-5-methylpyrimidin-4-amine is CCc1nc(Cl)c(C)c(NC2(C)CCOC2C)n1.
What is the InChIKey of 6-chloro-N-(2,3-dimethyloxolan-3-yl)-2-ethyl-5-methylpyrimidin-4-amine?
The InChIKey is JLAWQNFBLKAHFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20ClN3O/c1-5-10-15-11(14)8(2)12(16-10)17-13(4)6-7-18-9(13)3/h9H,5-7H2,1-4H3,(H,15,16,17).
What are the key properties of 6-chloro-N-(2,3-dimethyloxolan-3-yl)-2-ethyl-5-methylpyrimidin-4-amine?
6-chloro-N-(2,3-dimethyloxolan-3-yl)-2-ethyl-5-methylpyrimidin-4-amine has a molecular weight of 269.78 g/mol, XLogP of 2.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(2,3-dimethyloxolan-3-yl)-2-ethyl-5-methylpyrimidin-4-amine is sourced from PubChem (CID 114096231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).