About N-[2-(1-aminocyclohexyl)ethyl]tricyclo[3.2.1.02,4]octan-3-amine
N-[2-(1-aminocyclohexyl)ethyl]tricyclo[3.2.1.02,4]octan-3-amine (PubChem CID 114096315) has the molecular formula C16H28N2
and a molecular weight of 248.41 g/mol. Its IUPAC name is N-[2-(1-aminocyclohexyl)ethyl]tricyclo[3.2.1.02,4]octan-3-amine.
Molecular Properties
| Compound Name | N-[2-(1-aminocyclohexyl)ethyl]tricyclo[3.2.1.02,4]octan-3-amine |
| PubChem CID | 114096315 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N-[2-(1-aminocyclohexyl)ethyl]tricyclo[3.2.1.02,4]octan-3-amine |
| SMILES | NC1(CCNC2C3C4CCC(C4)C23)CCCCC1 |
| InChI | InChI=1S/C16H28N2/c17-16(6-2-1-3-7-16)8-9-18-15-13-11-4-5-12(10-11)14(13)15/h11-15,18H,1-10,17H2 |
| InChIKey | IUMMZVHIWXGWRF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(1-aminocyclohexyl)ethyl]tricyclo[3.2.1.02,4]octan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1-aminocyclohexyl)ethyl]tricyclo[3.2.1.02,4]octan-3-amine?
The IUPAC name of N-[2-(1-aminocyclohexyl)ethyl]tricyclo[3.2.1.02,4]octan-3-amine (CID 114096315) is N-[2-(1-aminocyclohexyl)ethyl]tricyclo[3.2.1.02,4]octan-3-amine.
What is the SMILES notation for N-[2-(1-aminocyclohexyl)ethyl]tricyclo[3.2.1.02,4]octan-3-amine?
The canonical SMILES for N-[2-(1-aminocyclohexyl)ethyl]tricyclo[3.2.1.02,4]octan-3-amine is NC1(CCNC2C3C4CCC(C4)C23)CCCCC1.
What is the InChIKey of N-[2-(1-aminocyclohexyl)ethyl]tricyclo[3.2.1.02,4]octan-3-amine?
The InChIKey is IUMMZVHIWXGWRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2/c17-16(6-2-1-3-7-16)8-9-18-15-13-11-4-5-12(10-11)14(13)15/h11-15,18H,1-10,17H2.
What are the key properties of N-[2-(1-aminocyclohexyl)ethyl]tricyclo[3.2.1.02,4]octan-3-amine?
N-[2-(1-aminocyclohexyl)ethyl]tricyclo[3.2.1.02,4]octan-3-amine has a molecular weight of 248.41 g/mol, XLogP of 2.67, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1-aminocyclohexyl)ethyl]tricyclo[3.2.1.02,4]octan-3-amine is sourced from PubChem (CID 114096315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).