C13H17N3O — CID 114096512
6-methoxy-N-(3-tricyclo[3.2.1.02,4]octanyl)pyrimidin-4-amine (PubChem CID 114096512) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 6-methoxy-N-(3-tricyclo[3.2.1.02,4]octanyl)pyrimidin-4-amine.
| Compound Name | 6-methoxy-N-(3-tricyclo[3.2.1.02,4]octanyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114096512 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 6-methoxy-N-(3-tricyclo[3.2.1.02,4]octanyl)pyrimidin-4-amine |
| SMILES | COc1cc(NC2C3C4CCC(C4)C23)ncn1 |
| InChI | InChI=1S/C13H17N3O/c1-17-10-5-9(14-6-15-10)16-13-11-7-2-3-8(4-7)12(11)13/h5-8,11-13H,2-4H2,1H3,(H,14,15,16) |
| InChIKey | JLGTXQMIBJWJIB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |