C15H24BrNO — CID 114097196
N-(3-bromopropyl)-N-propan-2-yltricyclo[3.2.1.02,4]octane-3-carboxamide (PubChem CID 114097196) has the molecular formula C15H24BrNO and a molecular weight of 314.27 g/mol. Its IUPAC name is N-(3-bromopropyl)-N-propan-2-yltricyclo[3.2.1.02,4]octane-3-carboxamide.
| Compound Name | N-(3-bromopropyl)-N-propan-2-yltricyclo[3.2.1.02,4]octane-3-carboxamide |
|---|---|
| PubChem CID | 114097196 |
| Molecular Formula | C15H24BrNO |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N-(3-bromopropyl)-N-propan-2-yltricyclo[3.2.1.02,4]octane-3-carboxamide |
| SMILES | CC(C)N(CCCBr)C(=O)C1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C15H24BrNO/c1-9(2)17(7-3-6-16)15(18)14-12-10-4-5-11(8-10)13(12)14/h9-14H,3-8H2,1-2H3 |
| InChIKey | JFXDCNFWYPJZTN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|