C24H47IO2Si — CID 11409855
[(E,2S)-1-[(2S,5S,6S)-6-(iodomethyl)-5-methyloxan-2-yl]-6-methylhept-3-en-2-yl]oxy-tri(propan-2-yl)silane (PubChem CID 11409855) has the molecular formula C24H47IO2Si and a molecular weight of 522.63 g/mol. Its IUPAC name is [(E,2S)-1-[(2S,5S,6S)-6-(iodomethyl)-5-methyloxan-2-yl]-6-methylhept-3-en-2-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(E,2S)-1-[(2S,5S,6S)-6-(iodomethyl)-5-methyloxan-2-yl]-6-methylhept-3-en-2-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11409855 |
| Molecular Formula | C24H47IO2Si |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | [(E,2S)-1-[(2S,5S,6S)-6-(iodomethyl)-5-methyloxan-2-yl]-6-methylhept-3-en-2-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)C/C=C/[C@H](C[C@@H]1CC[C@H](C)[C@@H](CI)O1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H47IO2Si/c1-17(2)11-10-12-23(15-22-14-13-21(9)24(16-25)26-22)27-28(18(3)4,19(5)6)20(7)8/h10,12,17-24H,11,13-16H2,1-9H3/b12-10+/t21-,22-,23+,24+/m0/s1 |
| InChIKey | VRVGDKGRHNKPCK-GRIOZMCCSA-N |
| XLogP | 8.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|