C29H25N5O5 — CID 11409866
methyl 1-(7-acetamido-5,8-dioxo-6-pyrrolidin-1-ylquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 11409866) has the molecular formula C29H25N5O5 and a molecular weight of 523.55 g/mol. Its IUPAC name is methyl 1-(7-acetamido-5,8-dioxo-6-pyrrolidin-1-ylquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 1-(7-acetamido-5,8-dioxo-6-pyrrolidin-1-ylquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 11409866 |
| Molecular Formula | C29H25N5O5 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | methyl 1-(7-acetamido-5,8-dioxo-6-pyrrolidin-1-ylquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc3c(n2)C(=O)C(NC(C)=O)=C(N2CCCC2)C3=O)c2[nH]c3ccccc3c2c1C |
| InChI | InChI=1S/C29H25N5O5/c1-14-20-16-8-4-5-9-18(16)31-24(20)23(33-21(14)29(38)39-3)19-11-10-17-22(32-19)28(37)25(30-15(2)35)26(27(17)36)34-12-6-7-13-34/h4-5,8-11,31H,6-7,12-13H2,1-3H3,(H,30,35) |
| InChIKey | NBONZOWLWFSABV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|