C13H22N4O — CID 114098683
4-N-[2-(cyclopropylmethoxy)ethyl]-6-N-propylpyrimidine-4,6-diamine (PubChem CID 114098683) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 4-N-[2-(cyclopropylmethoxy)ethyl]-6-N-propylpyrimidine-4,6-diamine.
| Compound Name | 4-N-[2-(cyclopropylmethoxy)ethyl]-6-N-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 114098683 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 4-N-[2-(cyclopropylmethoxy)ethyl]-6-N-propylpyrimidine-4,6-diamine |
| SMILES | CCCNc1cc(NCCOCC2CC2)ncn1 |
| InChI | InChI=1S/C13H22N4O/c1-2-5-14-12-8-13(17-10-16-12)15-6-7-18-9-11-3-4-11/h8,10-11H,2-7,9H2,1H3,(H2,14,15,16,17) |
| InChIKey | XAICCRFWZMGQNJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|