C28H50O7Si — CID 11409908
methyl (1S,4aS,5R,7R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-(6,6-dimethoxy-3-oxohexyl)-1,4a-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 11409908) has the molecular formula C28H50O7Si and a molecular weight of 526.79 g/mol. Its IUPAC name is methyl (1S,4aS,5R,7R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-(6,6-dimethoxy-3-oxohexyl)-1,4a-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aS,5R,7R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-(6,6-dimethoxy-3-oxohexyl)-1,4a-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 11409908 |
| Molecular Formula | C28H50O7Si |
| Molecular Weight | 526.79 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | methyl (1S,4aS,5R,7R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-(6,6-dimethoxy-3-oxohexyl)-1,4a-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@@]2(C)[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@@H]2CCC(=O)CCC(OC)OC |
| InChI | InChI=1S/C28H50O7Si/c1-26(2,3)36(9,10)35-21-18-22-27(4,16-11-17-28(22,5)25(31)34-8)20(24(21)30)14-12-19(29)13-15-23(32-6)33-7/h20-23H,11-18H2,1-10H3/t20-,21+,22+,27+,28-/m0/s1 |
| InChIKey | GMCXFEZOXOISNW-BCYBXAMJSA-N |
| XLogP | 5.70 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.79 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|