C21H20F3N5O — CID 11409968
3-[[3-amino-7-methyl-6-[2-(trifluoromethyl)phenyl]pyrrolo[3,2-f]quinazolin-1-yl]amino]propan-1-ol (PubChem CID 11409968) has the molecular formula C21H20F3N5O and a molecular weight of 415.42 g/mol. Its IUPAC name is 3-[[3-amino-7-methyl-6-[2-(trifluoromethyl)phenyl]pyrrolo[3,2-f]quinazolin-1-yl]amino]propan-1-ol.
| Compound Name | 3-[[3-amino-7-methyl-6-[2-(trifluoromethyl)phenyl]pyrrolo[3,2-f]quinazolin-1-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 11409968 |
| Molecular Formula | C21H20F3N5O |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 3-[[3-amino-7-methyl-6-[2-(trifluoromethyl)phenyl]pyrrolo[3,2-f]quinazolin-1-yl]amino]propan-1-ol |
| SMILES | Cn1ccc2c3c(NCCCO)nc(N)nc3cc(-c3ccccc3C(F)(F)F)c21 |
| InChI | InChI=1S/C21H20F3N5O/c1-29-9-7-13-17-16(27-20(25)28-19(17)26-8-4-10-30)11-14(18(13)29)12-5-2-3-6-15(12)21(22,23)24/h2-3,5-7,9,11,30H,4,8,10H2,1H3,(H3,25,26,27,28) |
| InChIKey | RKQXLIQYPYDMRF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|